C52H76N6S2 — CID 101460190
3,17-bis(4-tert-butylphenyl)-7,10,13,21,24,27-hexamethyl-30,33-dithia-7,10,13,21,24,27-hexazatetracyclo[13.13.6.05,29.019,34]tetratriaconta-1,3,5(29),15(34),16,18-hexaene (PubChem CID 101460190) has the molecular formula C52H76N6S2 and a molecular weight of 849.36 g/mol. Its IUPAC name is 3,17-bis(4-tert-butylphenyl)-7,10,13,21,24,27-hexamethyl-30,33-dithia-7,10,13,21,24,27-hexazatetracyclo[13.13.6.05,29.019,34]tetratriaconta-1,3,5(29),15(34),16,18-hexaene.
| Compound Name | 3,17-bis(4-tert-butylphenyl)-7,10,13,21,24,27-hexamethyl-30,33-dithia-7,10,13,21,24,27-hexazatetracyclo[13.13.6.05,29.019,34]tetratriaconta-1,3,5(29),15(34),16,18-hexaene |
|---|---|
| PubChem CID | 101460190 |
| Molecular Formula | C52H76N6S2 |
| Molecular Weight | 849.36 g/mol |
| Exact Mass | 848.56 |
| IUPAC Name | 3,17-bis(4-tert-butylphenyl)-7,10,13,21,24,27-hexamethyl-30,33-dithia-7,10,13,21,24,27-hexazatetracyclo[13.13.6.05,29.019,34]tetratriaconta-1,3,5(29),15(34),16,18-hexaene |
| SMILES | CN1CCN(C)Cc2cc(-c3ccc(C(C)(C)C)cc3)cc3c2SCCSc2c(cc(-c4ccc(C(C)(C)C)cc4)cc2CN(C)CCN(C)CCN(C)C3)CN(C)CC1 |
| InChI | InChI=1S/C52H76N6S2/c1-51(2,3)47-17-13-39(14-18-47)41-31-43-35-55(9)25-21-53(7)23-27-57(11)37-45-33-42(40-15-19-48(20-16-40)52(4,5)6)34-46-38-58(12)28-24-54(8)22-26-56(10)36-44(32-41)49(43)59-29-30-60-50(45)46/h13-20,31-34H,21-30,35-38H2,1-12H3 |
| InChIKey | JPIMINOZHZDRQA-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.36 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |