C24H17I2NO2S — CID 10146042
2-(3-ethyl-1,3-benzothiazol-2-ylidene)-1,3-bis(4-iodophenyl)propane-1,3-dione (PubChem CID 10146042) has the molecular formula C24H17I2NO2S and a molecular weight of 637.28 g/mol. Its IUPAC name is 2-(3-ethyl-1,3-benzothiazol-2-ylidene)-1,3-bis(4-iodophenyl)propane-1,3-dione.
| Compound Name | 2-(3-ethyl-1,3-benzothiazol-2-ylidene)-1,3-bis(4-iodophenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 10146042 |
| Molecular Formula | C24H17I2NO2S |
| Molecular Weight | 637.28 g/mol |
| Exact Mass | 636.91 |
| IUPAC Name | 2-(3-ethyl-1,3-benzothiazol-2-ylidene)-1,3-bis(4-iodophenyl)propane-1,3-dione |
| SMILES | CCN1C(=C(C(=O)c2ccc(I)cc2)C(=O)c2ccc(I)cc2)Sc2ccccc21 |
| InChI | InChI=1S/C24H17I2NO2S/c1-2-27-19-5-3-4-6-20(19)30-24(27)21(22(28)15-7-11-17(25)12-8-15)23(29)16-9-13-18(26)14-10-16/h3-14H,2H2,1H3 |
| InChIKey | RNIFUHCWZLRZJB-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.28 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|