About (5Z)-5-benzylidene-3,4-bis(2,5-dimethylthiophen-3-yl)furan-2-one
(5Z)-5-benzylidene-3,4-bis(2,5-dimethylthiophen-3-yl)furan-2-one (PubChem CID 101460675) has the molecular formula C23H20O2S2
and a molecular weight of 392.55 g/mol. Its IUPAC name is (5Z)-5-benzylidene-3,4-bis(2,5-dimethylthiophen-3-yl)furan-2-one.
Molecular Properties
| Compound Name | (5Z)-5-benzylidene-3,4-bis(2,5-dimethylthiophen-3-yl)furan-2-one |
| PubChem CID | 101460675 |
| Molecular Formula | C23H20O2S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | (5Z)-5-benzylidene-3,4-bis(2,5-dimethylthiophen-3-yl)furan-2-one |
| SMILES | Cc1cc(C2=C(c3cc(C)sc3C)/C(=C/c3ccccc3)OC2=O)c(C)s1 |
| InChI | InChI=1S/C23H20O2S2/c1-13-10-18(15(3)26-13)21-20(12-17-8-6-5-7-9-17)25-23(24)22(21)19-11-14(2)27-16(19)4/h5-12H,1-4H3/b20-12- |
| InChIKey | FDDKNBKEBCUJJS-NDENLUEZSA-N |
| XLogP | 6.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5Z)-5-benzylidene-3,4-bis(2,5-dimethylthiophen-3-yl)furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-benzylidene-3,4-bis(2,5-dimethylthiophen-3-yl)furan-2-one?
The IUPAC name of (5Z)-5-benzylidene-3,4-bis(2,5-dimethylthiophen-3-yl)furan-2-one (CID 101460675) is (5Z)-5-benzylidene-3,4-bis(2,5-dimethylthiophen-3-yl)furan-2-one.
What is the SMILES notation for (5Z)-5-benzylidene-3,4-bis(2,5-dimethylthiophen-3-yl)furan-2-one?
The canonical SMILES for (5Z)-5-benzylidene-3,4-bis(2,5-dimethylthiophen-3-yl)furan-2-one is Cc1cc(C2=C(c3cc(C)sc3C)/C(=C/c3ccccc3)OC2=O)c(C)s1.
What is the InChIKey of (5Z)-5-benzylidene-3,4-bis(2,5-dimethylthiophen-3-yl)furan-2-one?
The InChIKey is FDDKNBKEBCUJJS-NDENLUEZSA-N. The full InChI is InChI=1S/C23H20O2S2/c1-13-10-18(15(3)26-13)21-20(12-17-8-6-5-7-9-17)25-23(24)22(21)19-11-14(2)27-16(19)4/h5-12H,1-4H3/b20-12-.
What are the key properties of (5Z)-5-benzylidene-3,4-bis(2,5-dimethylthiophen-3-yl)furan-2-one?
(5Z)-5-benzylidene-3,4-bis(2,5-dimethylthiophen-3-yl)furan-2-one has a molecular weight of 392.55 g/mol, XLogP of 6.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-benzylidene-3,4-bis(2,5-dimethylthiophen-3-yl)furan-2-one is sourced from PubChem (CID 101460675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).