About 7-methyl-2,4-diphenyl-3,1,5-benzoxadiazepine
7-methyl-2,4-diphenyl-3,1,5-benzoxadiazepine (PubChem CID 101460737) has the molecular formula C21H16N2O
and a molecular weight of 312.37 g/mol. Its IUPAC name is 7-methyl-2,4-diphenyl-3,1,5-benzoxadiazepine.
Molecular Properties
| Compound Name | 7-methyl-2,4-diphenyl-3,1,5-benzoxadiazepine |
| PubChem CID | 101460737 |
| Molecular Formula | C21H16N2O |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 7-methyl-2,4-diphenyl-3,1,5-benzoxadiazepine |
| SMILES | Cc1ccc2c(c1)N=C(c1ccccc1)OC(c1ccccc1)=N2 |
| InChI | InChI=1S/C21H16N2O/c1-15-12-13-18-19(14-15)23-21(17-10-6-3-7-11-17)24-20(22-18)16-8-4-2-5-9-16/h2-14H,1H3 |
| InChIKey | FFSOXTWRDHKIRY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-2,4-diphenyl-3,1,5-benzoxadiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2,4-diphenyl-3,1,5-benzoxadiazepine?
The IUPAC name of 7-methyl-2,4-diphenyl-3,1,5-benzoxadiazepine (CID 101460737) is 7-methyl-2,4-diphenyl-3,1,5-benzoxadiazepine.
What is the SMILES notation for 7-methyl-2,4-diphenyl-3,1,5-benzoxadiazepine?
The canonical SMILES for 7-methyl-2,4-diphenyl-3,1,5-benzoxadiazepine is Cc1ccc2c(c1)N=C(c1ccccc1)OC(c1ccccc1)=N2.
What is the InChIKey of 7-methyl-2,4-diphenyl-3,1,5-benzoxadiazepine?
The InChIKey is FFSOXTWRDHKIRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O/c1-15-12-13-18-19(14-15)23-21(17-10-6-3-7-11-17)24-20(22-18)16-8-4-2-5-9-16/h2-14H,1H3.
What are the key properties of 7-methyl-2,4-diphenyl-3,1,5-benzoxadiazepine?
7-methyl-2,4-diphenyl-3,1,5-benzoxadiazepine has a molecular weight of 312.37 g/mol, XLogP of 5.18, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2,4-diphenyl-3,1,5-benzoxadiazepine is sourced from PubChem (CID 101460737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).