C32H24ClN5O8 — CID 10146114
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-N-(4-nitrophenyl)-N-[(4-nitrophenyl)carbamoyl]acetamide (PubChem CID 10146114) has the molecular formula C32H24ClN5O8 and a molecular weight of 642.02 g/mol. Its IUPAC name is 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-N-(4-nitrophenyl)-N-[(4-nitrophenyl)carbamoyl]acetamide.
| Compound Name | 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-N-(4-nitrophenyl)-N-[(4-nitrophenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 10146114 |
| Molecular Formula | C32H24ClN5O8 |
| Molecular Weight | 642.02 g/mol |
| Exact Mass | 641.13 |
| IUPAC Name | 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-N-(4-nitrophenyl)-N-[(4-nitrophenyl)carbamoyl]acetamide |
| SMILES | COc1ccc2c(c1)c(CC(=O)N(C(=O)Nc1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H24ClN5O8/c1-19-27(28-17-26(46-2)15-16-29(28)35(19)31(40)20-3-5-21(33)6-4-20)18-30(39)36(23-11-13-25(14-12-23)38(44)45)32(41)34-22-7-9-24(10-8-22)37(42)43/h3-17H,18H2,1-2H3,(H,34,41) |
| InChIKey | LPAGFVRDDKXONA-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 166.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.02 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|