C15H22O6 — CID 101461293
(2R,3S,3aR,4S,5'R,6'S,7aS)-2,5',6'-trihydroxy-1',2,4-trimethylspiro[3a,4,5,7a-tetrahydrofuro[2,3-c]pyran-3,4'-cyclohexene]-7-one (PubChem CID 101461293) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is (2R,3S,3aR,4S,5'R,6'S,7aS)-2,5',6'-trihydroxy-1',2,4-trimethylspiro[3a,4,5,7a-tetrahydrofuro[2,3-c]pyran-3,4'-cyclohexene]-7-one.
| Compound Name | (2R,3S,3aR,4S,5'R,6'S,7aS)-2,5',6'-trihydroxy-1',2,4-trimethylspiro[3a,4,5,7a-tetrahydrofuro[2,3-c]pyran-3,4'-cyclohexene]-7-one |
|---|---|
| PubChem CID | 101461293 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (2R,3S,3aR,4S,5'R,6'S,7aS)-2,5',6'-trihydroxy-1',2,4-trimethylspiro[3a,4,5,7a-tetrahydrofuro[2,3-c]pyran-3,4'-cyclohexene]-7-one |
| SMILES | CC1=CC[C@]2([C@H]3[C@H](C)COC(=O)[C@H]3O[C@@]2(C)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H22O6/c1-7-4-5-15(12(17)10(7)16)9-8(2)6-20-13(18)11(9)21-14(15,3)19/h4,8-12,16-17,19H,5-6H2,1-3H3/t8-,9+,10+,11+,12+,14-,15+/m1/s1 |
| InChIKey | ACFYJUDPZWXDFR-SWXINMIGSA-N |
| XLogP | -0.04 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|