C3H9N6+ — CID 101461462
1-methyl-1,2,4-triazol-4-ium-3,4,5-triamine (PubChem CID 101461462) has the molecular formula C3H9N6+ and a molecular weight of 129.15 g/mol. Its IUPAC name is 1-methyl-1,2,4-triazol-4-ium-3,4,5-triamine.
| Compound Name | 1-methyl-1,2,4-triazol-4-ium-3,4,5-triamine |
|---|---|
| PubChem CID | 101461462 |
| Molecular Formula | C3H9N6+ |
| Molecular Weight | 129.15 g/mol |
| Exact Mass | 129.09 |
| IUPAC Name | 1-methyl-1,2,4-triazol-4-ium-3,4,5-triamine |
| SMILES | Cn1nc(N)[n+](N)c1N |
| InChI | InChI=1S/C3H8N6/c1-8-3(5)9(6)2(4)7-8/h5H,6H2,1H3,(H2,4,7)/p+1 |
| InChIKey | GUDBAIGCHSLIEU-UHFFFAOYSA-O |
| XLogP | -2.41 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.15 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|