About [(E)-4-(2-oxo-1,3-oxazolidin-3-yl)but-3-en-2-yl] 3-methylbutanoate
[(E)-4-(2-oxo-1,3-oxazolidin-3-yl)but-3-en-2-yl] 3-methylbutanoate (PubChem CID 101461604) has the molecular formula C12H19NO4
and a molecular weight of 241.29 g/mol. Its IUPAC name is [(E)-4-(2-oxo-1,3-oxazolidin-3-yl)but-3-en-2-yl] 3-methylbutanoate.
Molecular Properties
| Compound Name | [(E)-4-(2-oxo-1,3-oxazolidin-3-yl)but-3-en-2-yl] 3-methylbutanoate |
| PubChem CID | 101461604 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | [(E)-4-(2-oxo-1,3-oxazolidin-3-yl)but-3-en-2-yl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OC(C)/C=C/N1CCOC1=O |
| InChI | InChI=1S/C12H19NO4/c1-9(2)8-11(14)17-10(3)4-5-13-6-7-16-12(13)15/h4-5,9-10H,6-8H2,1-3H3/b5-4+ |
| InChIKey | ZVAOAMNWXGHAPD-SNAWJCMRSA-N |
| XLogP | 1.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(E)-4-(2-oxo-1,3-oxazolidin-3-yl)but-3-en-2-yl] 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4-(2-oxo-1,3-oxazolidin-3-yl)but-3-en-2-yl] 3-methylbutanoate?
The IUPAC name of [(E)-4-(2-oxo-1,3-oxazolidin-3-yl)but-3-en-2-yl] 3-methylbutanoate (CID 101461604) is [(E)-4-(2-oxo-1,3-oxazolidin-3-yl)but-3-en-2-yl] 3-methylbutanoate.
What is the SMILES notation for [(E)-4-(2-oxo-1,3-oxazolidin-3-yl)but-3-en-2-yl] 3-methylbutanoate?
The canonical SMILES for [(E)-4-(2-oxo-1,3-oxazolidin-3-yl)but-3-en-2-yl] 3-methylbutanoate is CC(C)CC(=O)OC(C)/C=C/N1CCOC1=O.
What is the InChIKey of [(E)-4-(2-oxo-1,3-oxazolidin-3-yl)but-3-en-2-yl] 3-methylbutanoate?
The InChIKey is ZVAOAMNWXGHAPD-SNAWJCMRSA-N. The full InChI is InChI=1S/C12H19NO4/c1-9(2)8-11(14)17-10(3)4-5-13-6-7-16-12(13)15/h4-5,9-10H,6-8H2,1-3H3/b5-4+.
What are the key properties of [(E)-4-(2-oxo-1,3-oxazolidin-3-yl)but-3-en-2-yl] 3-methylbutanoate?
[(E)-4-(2-oxo-1,3-oxazolidin-3-yl)but-3-en-2-yl] 3-methylbutanoate has a molecular weight of 241.29 g/mol, XLogP of 1.93, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4-(2-oxo-1,3-oxazolidin-3-yl)but-3-en-2-yl] 3-methylbutanoate is sourced from PubChem (CID 101461604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).