C19H17BrN2O — CID 101461661
(3S,3aR,9bS)-8-bromo-1-methyl-3-phenyl-2,3,4,9b-tetrahydrochromeno[4,3-b]pyrrole-3a-carbonitrile (PubChem CID 101461661) has the molecular formula C19H17BrN2O and a molecular weight of 369.26 g/mol. Its IUPAC name is (3S,3aR,9bS)-8-bromo-1-methyl-3-phenyl-2,3,4,9b-tetrahydrochromeno[4,3-b]pyrrole-3a-carbonitrile.
| Compound Name | (3S,3aR,9bS)-8-bromo-1-methyl-3-phenyl-2,3,4,9b-tetrahydrochromeno[4,3-b]pyrrole-3a-carbonitrile |
|---|---|
| PubChem CID | 101461661 |
| Molecular Formula | C19H17BrN2O |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | (3S,3aR,9bS)-8-bromo-1-methyl-3-phenyl-2,3,4,9b-tetrahydrochromeno[4,3-b]pyrrole-3a-carbonitrile |
| SMILES | CN1C[C@@H](c2ccccc2)[C@@]2(C#N)COc3ccc(Br)cc3[C@@H]12 |
| InChI | InChI=1S/C19H17BrN2O/c1-22-10-16(13-5-3-2-4-6-13)19(11-21)12-23-17-8-7-14(20)9-15(17)18(19)22/h2-9,16,18H,10,12H2,1H3/t16-,18+,19+/m0/s1 |
| InChIKey | UFBWRDZWCXZMMP-QXAKKESOSA-N |
| XLogP | 4.12 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |