C21H34O6 — CID 101462360
(2R,3S)-2-[(2R,3R,4R,5S,7R,9R)-3-hydroxy-2-[(1R)-1-hydroxypropyl]-2,4,7,9-tetramethyl-1,6-dioxaspiro[4.4]nonan-7-yl]-3,5-dimethyl-2,3-dihydropyran-6-one (PubChem CID 101462360) has the molecular formula C21H34O6 and a molecular weight of 382.50 g/mol. Its IUPAC name is (2R,3S)-2-[(2R,3R,4R,5S,7R,9R)-3-hydroxy-2-[(1R)-1-hydroxypropyl]-2,4,7,9-tetramethyl-1,6-dioxaspiro[4.4]nonan-7-yl]-3,5-dimethyl-2,3-dihydropyran-6-one.
| Compound Name | (2R,3S)-2-[(2R,3R,4R,5S,7R,9R)-3-hydroxy-2-[(1R)-1-hydroxypropyl]-2,4,7,9-tetramethyl-1,6-dioxaspiro[4.4]nonan-7-yl]-3,5-dimethyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 101462360 |
| Molecular Formula | C21H34O6 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | (2R,3S)-2-[(2R,3R,4R,5S,7R,9R)-3-hydroxy-2-[(1R)-1-hydroxypropyl]-2,4,7,9-tetramethyl-1,6-dioxaspiro[4.4]nonan-7-yl]-3,5-dimethyl-2,3-dihydropyran-6-one |
| SMILES | CC[C@@H](O)[C@@]1(C)O[C@]2(O[C@@](C)([C@@H]3OC(=O)C(C)=C[C@@H]3C)C[C@H]2C)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C21H34O6/c1-8-15(22)20(7)16(23)14(5)21(27-20)13(4)10-19(6,26-21)17-11(2)9-12(3)18(24)25-17/h9,11,13-17,22-23H,8,10H2,1-7H3/t11-,13+,14+,15+,16+,17+,19+,20+,21-/m0/s1 |
| InChIKey | PUWSWDPZBXOVMY-BHHRPFDZSA-N |
| XLogP | 2.56 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |