C21H26O7 — CID 101462610
(2S,3S,4aS,4bR,12aR)-2,3,9-trimethoxy-2,3,11-trimethyl-4a,4b,12,12a-tetrahydroisochromeno[4,3-h][1,4]benzodioxin-6-one (PubChem CID 101462610) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is (2S,3S,4aS,4bR,12aR)-2,3,9-trimethoxy-2,3,11-trimethyl-4a,4b,12,12a-tetrahydroisochromeno[4,3-h][1,4]benzodioxin-6-one.
| Compound Name | (2S,3S,4aS,4bR,12aR)-2,3,9-trimethoxy-2,3,11-trimethyl-4a,4b,12,12a-tetrahydroisochromeno[4,3-h][1,4]benzodioxin-6-one |
|---|---|
| PubChem CID | 101462610 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (2S,3S,4aS,4bR,12aR)-2,3,9-trimethoxy-2,3,11-trimethyl-4a,4b,12,12a-tetrahydroisochromeno[4,3-h][1,4]benzodioxin-6-one |
| SMILES | COc1ccc2c(c1)C1=C(C)C[C@H]3O[C@](C)(OC)[C@@](C)(OC)O[C@@H]3[C@@H]1OC2=O |
| InChI | InChI=1S/C21H26O7/c1-11-9-15-17(28-21(3,25-6)20(2,24-5)27-15)18-16(11)14-10-12(23-4)7-8-13(14)19(22)26-18/h7-8,10,15,17-18H,9H2,1-6H3/t15-,17+,18-,20+,21+/m1/s1 |
| InChIKey | GVMKMDUMOFNTNW-WPLSPGFVSA-N |
| XLogP | 2.92 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |