C19H31NOSi — CID 101462792
N-benzyl-N-(1-trimethylsilylnon-1-yn-3-yl)hydroxylamine (PubChem CID 101462792) has the molecular formula C19H31NOSi and a molecular weight of 317.55 g/mol. Its IUPAC name is N-benzyl-N-(1-trimethylsilylnon-1-yn-3-yl)hydroxylamine.
| Compound Name | N-benzyl-N-(1-trimethylsilylnon-1-yn-3-yl)hydroxylamine |
|---|---|
| PubChem CID | 101462792 |
| Molecular Formula | C19H31NOSi |
| Molecular Weight | 317.55 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | N-benzyl-N-(1-trimethylsilylnon-1-yn-3-yl)hydroxylamine |
| SMILES | CCCCCCC(C#C[Si](C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C19H31NOSi/c1-5-6-7-11-14-19(15-16-22(2,3)4)20(21)17-18-12-9-8-10-13-18/h8-10,12-13,19,21H,5-7,11,14,17H2,1-4H3 |
| InChIKey | HQDCXVOFEVHVIO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|