C18H20N4Si — CID 101462972
bis(pyrrolo[2,3-b]pyridin-1-yl)methyl-trimethylsilane (PubChem CID 101462972) has the molecular formula C18H20N4Si and a molecular weight of 320.47 g/mol. Its IUPAC name is bis(pyrrolo[2,3-b]pyridin-1-yl)methyl-trimethylsilane.
| Compound Name | bis(pyrrolo[2,3-b]pyridin-1-yl)methyl-trimethylsilane |
|---|---|
| PubChem CID | 101462972 |
| Molecular Formula | C18H20N4Si |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | bis(pyrrolo[2,3-b]pyridin-1-yl)methyl-trimethylsilane |
| SMILES | C[Si](C)(C)C(n1ccc2cccnc21)n1ccc2cccnc21 |
| InChI | InChI=1S/C18H20N4Si/c1-23(2,3)18(21-12-8-14-6-4-10-19-16(14)21)22-13-9-15-7-5-11-20-17(15)22/h4-13,18H,1-3H3 |
| InChIKey | WDVASYAWSTXHBR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|