C24H28N2O4 — CID 101463486
dipropan-2-yl (15S,16S)-4,11-diaminotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dicarboxylate (PubChem CID 101463486) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is dipropan-2-yl (15S,16S)-4,11-diaminotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dicarboxylate.
| Compound Name | dipropan-2-yl (15S,16S)-4,11-diaminotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dicarboxylate |
|---|---|
| PubChem CID | 101463486 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | dipropan-2-yl (15S,16S)-4,11-diaminotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dicarboxylate |
| SMILES | CC(C)OC(=O)[C@H]1C2c3ccc(N)cc3C(c3ccc(N)cc32)[C@@H]1C(=O)OC(C)C |
| InChI | InChI=1S/C24H28N2O4/c1-11(2)29-23(27)21-19-15-7-5-14(26)10-18(15)20(22(21)24(28)30-12(3)4)16-8-6-13(25)9-17(16)19/h5-12,19-22H,25-26H2,1-4H3/t19?,20?,21-,22-/m0/s1 |
| InChIKey | UFYMOXILBACVGR-UJKMTWAASA-N |
| XLogP | 3.58 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|