C42H51FSSi2 — CID 101464262
2-[7-fluoro-2-[2-tri(propan-2-yl)silylethynyl]-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaen-12-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 101464262) has the molecular formula C42H51FSSi2 and a molecular weight of 663.11 g/mol. Its IUPAC name is 2-[7-fluoro-2-[2-tri(propan-2-yl)silylethynyl]-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaen-12-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[7-fluoro-2-[2-tri(propan-2-yl)silylethynyl]-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaen-12-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101464262 |
| Molecular Formula | C42H51FSSi2 |
| Molecular Weight | 663.11 g/mol |
| Exact Mass | 662.32 |
| IUPAC Name | 2-[7-fluoro-2-[2-tri(propan-2-yl)silylethynyl]-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaen-12-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cc1c2cc3ccccc3cc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)c2cc3sc(F)cc3cc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C42H51FSSi2/c1-26(2)45(27(3)4,28(5)6)19-17-35-37-21-32-15-13-14-16-33(32)22-38(37)36(18-20-46(29(7)8,30(9)10)31(11)12)40-25-41-34(23-39(35)40)24-42(43)44-41/h13-16,21-31H,1-12H3 |
| InChIKey | BGZZRFIKKLRKKZ-UHFFFAOYSA-N |
| XLogP | 13.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.11 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|