C14H15NS — CID 101464496
(3aS)-1,2,3,3a,4,10-hexahydro-[1]benzothiolo[2,3-f]indolizine (PubChem CID 101464496) has the molecular formula C14H15NS and a molecular weight of 229.35 g/mol. Its IUPAC name is (3aS)-1,2,3,3a,4,10-hexahydro-[1]benzothiolo[2,3-f]indolizine.
| Compound Name | (3aS)-1,2,3,3a,4,10-hexahydro-[1]benzothiolo[2,3-f]indolizine |
|---|---|
| PubChem CID | 101464496 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (3aS)-1,2,3,3a,4,10-hexahydro-[1]benzothiolo[2,3-f]indolizine |
| SMILES | c1ccc2c3c(sc2c1)CN1CCC[C@H]1C3 |
| InChI | InChI=1S/C14H15NS/c1-2-6-13-11(5-1)12-8-10-4-3-7-15(10)9-14(12)16-13/h1-2,5-6,10H,3-4,7-9H2/t10-/m0/s1 |
| InChIKey | CMNSOZQFVZBLFT-JTQLQIEISA-N |
| XLogP | 3.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |