C20H16N2 — CID 101464670
(10bR,10cR)-10b,10c-dimethyl-9,10-dihydropyrene-4,5-dicarbonitrile (PubChem CID 101464670) has the molecular formula C20H16N2 and a molecular weight of 284.36 g/mol. Its IUPAC name is (10bR,10cR)-10b,10c-dimethyl-9,10-dihydropyrene-4,5-dicarbonitrile.
| Compound Name | (10bR,10cR)-10b,10c-dimethyl-9,10-dihydropyrene-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 101464670 |
| Molecular Formula | C20H16N2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (10bR,10cR)-10b,10c-dimethyl-9,10-dihydropyrene-4,5-dicarbonitrile |
| SMILES | C[C@@]12C3=CC=CC1=C(C#N)C(C#N)=C1C=CC=C(CC3)[C@]12C |
| InChI | InChI=1S/C20H16N2/c1-19-13-5-3-7-17(19)15(11-21)16(12-22)18-8-4-6-14(10-9-13)20(18,19)2/h3-8H,9-10H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | WBUHCSKLKPTNBE-WOJBJXKFSA-N |
| XLogP | 4.44 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |