C29H23NS21 — CID 101464820
3-[[2-[4,5-bis[2-[[2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]ethylsulfanyl]-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]sulfanyl]propanenitrile (PubChem CID 101464820) has the molecular formula C29H23NS21 and a molecular weight of 1058.92 g/mol. Its IUPAC name is 3-[[2-[4,5-bis[2-[[2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]ethylsulfanyl]-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]sulfanyl]propanenitrile.
| Compound Name | 3-[[2-[4,5-bis[2-[[2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]ethylsulfanyl]-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 101464820 |
| Molecular Formula | C29H23NS21 |
| Molecular Weight | 1058.92 g/mol |
| Exact Mass | 1056.60 |
| IUPAC Name | 3-[[2-[4,5-bis[2-[[2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]ethylsulfanyl]-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]sulfanyl]propanenitrile |
| SMILES | N#CCCSC1=CSC(=C2SC(SCCSC3=CSC(=C4SC5=C(SCCS5)S4)S3)=C(SCCSC3=CSC(=C4SC5=C(SCCS5)S4)S3)S2)S1 |
| InChI | InChI=1S/C29H23NS21/c30-2-1-3-31-15-12-40-24(43-15)27-46-18(34-6-4-32-16-13-41-25(44-16)28-48-20-21(49-28)37-9-8-36-20)19(47-27)35-7-5-33-17-14-42-26(45-17)29-50-22-23(51-29)39-11-10-38-22/h12-14H,1,3-11H2 |
| InChIKey | XETKHALZKWHLBC-UHFFFAOYSA-N |
| XLogP | 17.56 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1058.92 |
| LogP ≤ 5 | 17.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|