C20H27N3O — CID 101465479
2-methyl-1-[(1S,2R,6S,7R)-7,10,10-trimethyl-4-pyridin-2-yl-3,5-diazatricyclo[5.2.1.02,6]dec-4-en-3-yl]propan-1-one (PubChem CID 101465479) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 2-methyl-1-[(1S,2R,6S,7R)-7,10,10-trimethyl-4-pyridin-2-yl-3,5-diazatricyclo[5.2.1.02,6]dec-4-en-3-yl]propan-1-one.
| Compound Name | 2-methyl-1-[(1S,2R,6S,7R)-7,10,10-trimethyl-4-pyridin-2-yl-3,5-diazatricyclo[5.2.1.02,6]dec-4-en-3-yl]propan-1-one |
|---|---|
| PubChem CID | 101465479 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 2-methyl-1-[(1S,2R,6S,7R)-7,10,10-trimethyl-4-pyridin-2-yl-3,5-diazatricyclo[5.2.1.02,6]dec-4-en-3-yl]propan-1-one |
| SMILES | CC(C)C(=O)N1C(c2ccccn2)=N[C@@H]2[C@H]1[C@H]1CC[C@]2(C)C1(C)C |
| InChI | InChI=1S/C20H27N3O/c1-12(2)18(24)23-15-13-9-10-20(5,19(13,3)4)16(15)22-17(23)14-8-6-7-11-21-14/h6-8,11-13,15-16H,9-10H2,1-5H3/t13-,15-,16-,20+/m1/s1 |
| InChIKey | UZDLFLKNFHWKRC-CQNRTFJUSA-N |
| XLogP | 3.52 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |