About (2S,5R)-2-tert-butyl-5-phenyl-5-pyridin-3-yl-1,3-dioxolan-4-one
(2S,5R)-2-tert-butyl-5-phenyl-5-pyridin-3-yl-1,3-dioxolan-4-one (PubChem CID 101465852) has the molecular formula C18H19NO3
and a molecular weight of 297.35 g/mol. Its IUPAC name is (2S,5R)-2-tert-butyl-5-phenyl-5-pyridin-3-yl-1,3-dioxolan-4-one.
Molecular Properties
| Compound Name | (2S,5R)-2-tert-butyl-5-phenyl-5-pyridin-3-yl-1,3-dioxolan-4-one |
| PubChem CID | 101465852 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2S,5R)-2-tert-butyl-5-phenyl-5-pyridin-3-yl-1,3-dioxolan-4-one |
| SMILES | CC(C)(C)[C@@H]1OC(=O)[C@@](c2ccccc2)(c2cccnc2)O1 |
| InChI | InChI=1S/C18H19NO3/c1-17(2,3)16-21-15(20)18(22-16,13-8-5-4-6-9-13)14-10-7-11-19-12-14/h4-12,16H,1-3H3/t16-,18-/m1/s1 |
| InChIKey | HUJLLSCNUQFKBJ-SJLPKXTDSA-N |
| XLogP | 3.27 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S,5R)-2-tert-butyl-5-phenyl-5-pyridin-3-yl-1,3-dioxolan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-2-tert-butyl-5-phenyl-5-pyridin-3-yl-1,3-dioxolan-4-one?
The IUPAC name of (2S,5R)-2-tert-butyl-5-phenyl-5-pyridin-3-yl-1,3-dioxolan-4-one (CID 101465852) is (2S,5R)-2-tert-butyl-5-phenyl-5-pyridin-3-yl-1,3-dioxolan-4-one.
What is the SMILES notation for (2S,5R)-2-tert-butyl-5-phenyl-5-pyridin-3-yl-1,3-dioxolan-4-one?
The canonical SMILES for (2S,5R)-2-tert-butyl-5-phenyl-5-pyridin-3-yl-1,3-dioxolan-4-one is CC(C)(C)[C@@H]1OC(=O)[C@@](c2ccccc2)(c2cccnc2)O1.
What is the InChIKey of (2S,5R)-2-tert-butyl-5-phenyl-5-pyridin-3-yl-1,3-dioxolan-4-one?
The InChIKey is HUJLLSCNUQFKBJ-SJLPKXTDSA-N. The full InChI is InChI=1S/C18H19NO3/c1-17(2,3)16-21-15(20)18(22-16,13-8-5-4-6-9-13)14-10-7-11-19-12-14/h4-12,16H,1-3H3/t16-,18-/m1/s1.
What are the key properties of (2S,5R)-2-tert-butyl-5-phenyl-5-pyridin-3-yl-1,3-dioxolan-4-one?
(2S,5R)-2-tert-butyl-5-phenyl-5-pyridin-3-yl-1,3-dioxolan-4-one has a molecular weight of 297.35 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-2-tert-butyl-5-phenyl-5-pyridin-3-yl-1,3-dioxolan-4-one is sourced from PubChem (CID 101465852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).