About 5-[di(cyclopenta-2,4-dien-1-yl)methylidene]cyclopenta-1,3-diene
5-[di(cyclopenta-2,4-dien-1-yl)methylidene]cyclopenta-1,3-diene (PubChem CID 101465899) has the molecular formula C16H14
and a molecular weight of 206.29 g/mol. Its IUPAC name is 5-[di(cyclopenta-2,4-dien-1-yl)methylidene]cyclopenta-1,3-diene.
Molecular Properties
| Compound Name | 5-[di(cyclopenta-2,4-dien-1-yl)methylidene]cyclopenta-1,3-diene |
| PubChem CID | 101465899 |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 5-[di(cyclopenta-2,4-dien-1-yl)methylidene]cyclopenta-1,3-diene |
| SMILES | C1=CC(=C(C2C=CC=C2)C2C=CC=C2)C=C1 |
| InChI | InChI=1S/C16H14/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15/h1-14H |
| InChIKey | RSMUBKVASXVZDM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-[di(cyclopenta-2,4-dien-1-yl)methylidene]cyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[di(cyclopenta-2,4-dien-1-yl)methylidene]cyclopenta-1,3-diene?
The IUPAC name of 5-[di(cyclopenta-2,4-dien-1-yl)methylidene]cyclopenta-1,3-diene (CID 101465899) is 5-[di(cyclopenta-2,4-dien-1-yl)methylidene]cyclopenta-1,3-diene.
What is the SMILES notation for 5-[di(cyclopenta-2,4-dien-1-yl)methylidene]cyclopenta-1,3-diene?
The canonical SMILES for 5-[di(cyclopenta-2,4-dien-1-yl)methylidene]cyclopenta-1,3-diene is C1=CC(=C(C2C=CC=C2)C2C=CC=C2)C=C1.
What is the InChIKey of 5-[di(cyclopenta-2,4-dien-1-yl)methylidene]cyclopenta-1,3-diene?
The InChIKey is RSMUBKVASXVZDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15/h1-14H.
What are the key properties of 5-[di(cyclopenta-2,4-dien-1-yl)methylidene]cyclopenta-1,3-diene?
5-[di(cyclopenta-2,4-dien-1-yl)methylidene]cyclopenta-1,3-diene has a molecular weight of 206.29 g/mol, XLogP of 3.89, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[di(cyclopenta-2,4-dien-1-yl)methylidene]cyclopenta-1,3-diene is sourced from PubChem (CID 101465899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).