C30H26O3 — CID 101467034
(4R,5S)-4-benzoyl-1-butyl-3,5-diphenyl-4,5-dihydrocyclopenta[c]furan-6-one (PubChem CID 101467034) has the molecular formula C30H26O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is (4R,5S)-4-benzoyl-1-butyl-3,5-diphenyl-4,5-dihydrocyclopenta[c]furan-6-one.
| Compound Name | (4R,5S)-4-benzoyl-1-butyl-3,5-diphenyl-4,5-dihydrocyclopenta[c]furan-6-one |
|---|---|
| PubChem CID | 101467034 |
| Molecular Formula | C30H26O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (4R,5S)-4-benzoyl-1-butyl-3,5-diphenyl-4,5-dihydrocyclopenta[c]furan-6-one |
| SMILES | CCCCc1oc(-c2ccccc2)c2c1C(=O)[C@H](c1ccccc1)[C@H]2C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H26O3/c1-2-3-19-23-25-27(30(33-23)22-17-11-6-12-18-22)26(28(31)21-15-9-5-10-16-21)24(29(25)32)20-13-7-4-8-14-20/h4-18,24,26H,2-3,19H2,1H3/t24-,26-/m1/s1 |
| InChIKey | BKBPYYCJQJTTDN-AOYPEHQESA-N |
| XLogP | 7.24 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |