C20H23NO2 — CID 101467124
(2R,3aR,4S)-2-phenyl-4-phenylmethoxy-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine (PubChem CID 101467124) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (2R,3aR,4S)-2-phenyl-4-phenylmethoxy-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine.
| Compound Name | (2R,3aR,4S)-2-phenyl-4-phenylmethoxy-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine |
|---|---|
| PubChem CID | 101467124 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (2R,3aR,4S)-2-phenyl-4-phenylmethoxy-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine |
| SMILES | c1ccc(CO[C@H]2CCCN3O[C@@H](c4ccccc4)C[C@H]23)cc1 |
| InChI | InChI=1S/C20H23NO2/c1-3-8-16(9-4-1)15-22-19-12-7-13-21-18(19)14-20(23-21)17-10-5-2-6-11-17/h1-6,8-11,18-20H,7,12-15H2/t18-,19+,20-/m1/s1 |
| InChIKey | RHCXEHUFMWCHHW-HSALFYBXSA-N |
| XLogP | 4.11 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |