C18H12N6 — CID 101467299
3,8-di(imidazol-1-yl)-1,10-phenanthroline (PubChem CID 101467299) has the molecular formula C18H12N6 and a molecular weight of 312.34 g/mol. Its IUPAC name is 3,8-di(imidazol-1-yl)-1,10-phenanthroline.
| Compound Name | 3,8-di(imidazol-1-yl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 101467299 |
| Molecular Formula | C18H12N6 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3,8-di(imidazol-1-yl)-1,10-phenanthroline |
| SMILES | c1cn(-c2cnc3c(ccc4cc(-n5ccnc5)cnc43)c2)cn1 |
| InChI | InChI=1S/C18H12N6/c1-2-14-8-16(24-6-4-20-12-24)10-22-18(14)17-13(1)7-15(9-21-17)23-5-3-19-11-23/h1-12H |
| InChIKey | YNRBOJQEYFECNY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|