C12H17NO2 — CID 101467380
(4S)-3-hexa-1,2,5-trien-3-yl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 101467380) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (4S)-3-hexa-1,2,5-trien-3-yl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-hexa-1,2,5-trien-3-yl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101467380 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (4S)-3-hexa-1,2,5-trien-3-yl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | C=C=C(CC=C)N1C(=O)OC[C@@H]1C(C)C |
| InChI | InChI=1S/C12H17NO2/c1-5-7-10(6-2)13-11(9(3)4)8-15-12(13)14/h5,9,11H,1-2,7-8H2,3-4H3/t11-/m1/s1 |
| InChIKey | OEXJLFDAMWNKFD-LLVKDONJSA-N |
| XLogP | 2.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|