C35H37F3N2O10 — CID 10146742
(2S,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;ethyl 4-amino-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 10146742) has the molecular formula C35H37F3N2O10 and a molecular weight of 702.68 g/mol. Its IUPAC name is (2S,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;ethyl 4-amino-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | (2S,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;ethyl 4-amino-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 10146742 |
| Molecular Formula | C35H37F3N2O10 |
| Molecular Weight | 702.68 g/mol |
| Exact Mass | 702.24 |
| IUPAC Name | (2S,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;ethyl 4-amino-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(C(F)(F)F)cc2C(N)CC1CC.Cc1ccc(C(=O)O[C@H](C(=O)O)[C@H](OC(=O)c2ccc(C)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H18O8.C15H19F3N2O2/c1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14;1-3-10-8-12(19)11-7-9(15(16,17)18)5-6-13(11)20(10)14(21)22-4-2/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24);5-7,10,12H,3-4,8,19H2,1-2H3/t15-,16-;/m0./s1 |
| InChIKey | IMTAQLATWYNPFQ-MOGJOVFKSA-N |
| XLogP | 6.07 |
| TPSA | 182.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.68 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|