C33H41Cl2N5O6S — CID 10146775
dimethyl 2-[2-[4-(3-acetamido-2,2-dimethylpropyl)piperazin-1-yl]-2-oxoethyl]-4-(2,6-dichlorophenyl)-6-[2-(1,3-thiazol-2-yl)ethyl]-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10146775) has the molecular formula C33H41Cl2N5O6S and a molecular weight of 706.69 g/mol. Its IUPAC name is dimethyl 2-[2-[4-(3-acetamido-2,2-dimethylpropyl)piperazin-1-yl]-2-oxoethyl]-4-(2,6-dichlorophenyl)-6-[2-(1,3-thiazol-2-yl)ethyl]-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 2-[2-[4-(3-acetamido-2,2-dimethylpropyl)piperazin-1-yl]-2-oxoethyl]-4-(2,6-dichlorophenyl)-6-[2-(1,3-thiazol-2-yl)ethyl]-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10146775 |
| Molecular Formula | C33H41Cl2N5O6S |
| Molecular Weight | 706.69 g/mol |
| Exact Mass | 705.22 |
| IUPAC Name | dimethyl 2-[2-[4-(3-acetamido-2,2-dimethylpropyl)piperazin-1-yl]-2-oxoethyl]-4-(2,6-dichlorophenyl)-6-[2-(1,3-thiazol-2-yl)ethyl]-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(CCc2nccs2)NC(CC(=O)N2CCN(CC(C)(C)CNC(C)=O)CC2)=C(C(=O)OC)C1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C33H41Cl2N5O6S/c1-20(41)37-18-33(2,3)19-39-12-14-40(15-13-39)26(42)17-24-29(32(44)46-5)30(27-21(34)7-6-8-22(27)35)28(31(43)45-4)23(38-24)9-10-25-36-11-16-47-25/h6-8,11,16,30,38H,9-10,12-15,17-19H2,1-5H3,(H,37,41) |
| InChIKey | HBTLNKWCVQWRCF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |