C16H25IN2Si — CID 101467931
1,3-ditert-butyl-2-iodo-2-phenyl-1,3,2-diazasilole (PubChem CID 101467931) has the molecular formula C16H25IN2Si and a molecular weight of 400.38 g/mol. Its IUPAC name is 1,3-ditert-butyl-2-iodo-2-phenyl-1,3,2-diazasilole.
| Compound Name | 1,3-ditert-butyl-2-iodo-2-phenyl-1,3,2-diazasilole |
|---|---|
| PubChem CID | 101467931 |
| Molecular Formula | C16H25IN2Si |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 1,3-ditert-butyl-2-iodo-2-phenyl-1,3,2-diazasilole |
| SMILES | CC(C)(C)N1C=CN(C(C)(C)C)[Si]1(I)c1ccccc1 |
| InChI | InChI=1S/C16H25IN2Si/c1-15(2,3)18-12-13-19(16(4,5)6)20(18,17)14-10-8-7-9-11-14/h7-13H,1-6H3 |
| InChIKey | TXJLJSFBGOVPHK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|