C41H48F5N3O2 — CID 10146799
2-[2-[2-(2,3-difluorophenyl)ethyl]-4-oxoquinolin-1-yl]-N-(1-ethylpiperidin-4-yl)-N-[8-[4-(trifluoromethyl)phenyl]octyl]acetamide (PubChem CID 10146799) has the molecular formula C41H48F5N3O2 and a molecular weight of 709.84 g/mol. Its IUPAC name is 2-[2-[2-(2,3-difluorophenyl)ethyl]-4-oxoquinolin-1-yl]-N-(1-ethylpiperidin-4-yl)-N-[8-[4-(trifluoromethyl)phenyl]octyl]acetamide.
| Compound Name | 2-[2-[2-(2,3-difluorophenyl)ethyl]-4-oxoquinolin-1-yl]-N-(1-ethylpiperidin-4-yl)-N-[8-[4-(trifluoromethyl)phenyl]octyl]acetamide |
|---|---|
| PubChem CID | 10146799 |
| Molecular Formula | C41H48F5N3O2 |
| Molecular Weight | 709.84 g/mol |
| Exact Mass | 709.37 |
| IUPAC Name | 2-[2-[2-(2,3-difluorophenyl)ethyl]-4-oxoquinolin-1-yl]-N-(1-ethylpiperidin-4-yl)-N-[8-[4-(trifluoromethyl)phenyl]octyl]acetamide |
| SMILES | CCN1CCC(N(CCCCCCCCc2ccc(C(F)(F)F)cc2)C(=O)Cn2c(CCc3cccc(F)c3F)cc(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C41H48F5N3O2/c1-2-47-26-23-33(24-27-47)48(25-10-6-4-3-5-7-12-30-17-20-32(21-18-30)41(44,45)46)39(51)29-49-34(22-19-31-13-11-15-36(42)40(31)43)28-38(50)35-14-8-9-16-37(35)49/h8-9,11,13-18,20-21,28,33H,2-7,10,12,19,22-27,29H2,1H3 |
| InChIKey | MTGQMPGBPSLIMJ-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.84 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|