C13H17NO3 — CID 101468384
methyl (2S,3R)-3-acetamido-2-methyl-3-phenylpropanoate (PubChem CID 101468384) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is methyl (2S,3R)-3-acetamido-2-methyl-3-phenylpropanoate.
| Compound Name | methyl (2S,3R)-3-acetamido-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 101468384 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | methyl (2S,3R)-3-acetamido-2-methyl-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](C)[C@@H](NC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C13H17NO3/c1-9(13(16)17-3)12(14-10(2)15)11-7-5-4-6-8-11/h4-9,12H,1-3H3,(H,14,15)/t9-,12+/m0/s1 |
| InChIKey | SGPUEXFPCJUZME-JOYOIKCWSA-N |
| XLogP | 1.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |