C13H14N2 — CID 101469061
N-[(1R)-1-cyclopenta-1,3-dien-1-ylethyl]-1-pyridin-2-ylmethanimine (PubChem CID 101469061) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is N-[(1R)-1-cyclopenta-1,3-dien-1-ylethyl]-1-pyridin-2-ylmethanimine.
| Compound Name | N-[(1R)-1-cyclopenta-1,3-dien-1-ylethyl]-1-pyridin-2-ylmethanimine |
|---|---|
| PubChem CID | 101469061 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | N-[(1R)-1-cyclopenta-1,3-dien-1-ylethyl]-1-pyridin-2-ylmethanimine |
| SMILES | C[C@@H](/N=C/c1ccccn1)C1=CC=CC1 |
| InChI | InChI=1S/C13H14N2/c1-11(12-6-2-3-7-12)15-10-13-8-4-5-9-14-13/h2-6,8-11H,7H2,1H3/b15-10+/t11-/m1/s1 |
| InChIKey | FHXJNPNNPQJCKF-HGLKBHAMSA-N |
| XLogP | 2.78 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|