C29H36O7 — CID 101469128
tert-butyl (E)-3-[2,3-bis[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]-1-benzofuran-5-yl]prop-2-enoate (PubChem CID 101469128) has the molecular formula C29H36O7 and a molecular weight of 496.60 g/mol. Its IUPAC name is tert-butyl (E)-3-[2,3-bis[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]-1-benzofuran-5-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[2,3-bis[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]-1-benzofuran-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 101469128 |
| Molecular Formula | C29H36O7 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | tert-butyl (E)-3-[2,3-bis[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]-1-benzofuran-5-yl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/c1ccc2oc(/C=C/C(=O)OC(C)(C)C)c(/C=C/C(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C29H36O7/c1-27(2,3)34-24(30)15-11-19-10-13-23-21(18-19)20(12-16-25(31)35-28(4,5)6)22(33-23)14-17-26(32)36-29(7,8)9/h10-18H,1-9H3/b15-11+,16-12+,17-14+ |
| InChIKey | DOHLRDKSTNCNOX-UKYUFSSYSA-N |
| XLogP | 6.50 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|