C31H36N2O2 — CID 101469202
[(2R,3S)-5-methyl-2-phenyl-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,3-dihydroindol-1-yl]-phenylmethanone (PubChem CID 101469202) has the molecular formula C31H36N2O2 and a molecular weight of 468.64 g/mol. Its IUPAC name is [(2R,3S)-5-methyl-2-phenyl-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,3-dihydroindol-1-yl]-phenylmethanone.
| Compound Name | [(2R,3S)-5-methyl-2-phenyl-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,3-dihydroindol-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 101469202 |
| Molecular Formula | C31H36N2O2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | [(2R,3S)-5-methyl-2-phenyl-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,3-dihydroindol-1-yl]-phenylmethanone |
| SMILES | Cc1ccc2c(c1)[C@H](ON1C(C)(C)CCCC1(C)C)[C@@H](c1ccccc1)N2C(=O)c1ccccc1 |
| InChI | InChI=1S/C31H36N2O2/c1-22-17-18-26-25(21-22)28(35-33-30(2,3)19-12-20-31(33,4)5)27(23-13-8-6-9-14-23)32(26)29(34)24-15-10-7-11-16-24/h6-11,13-18,21,27-28H,12,19-20H2,1-5H3/t27-,28+/m1/s1 |
| InChIKey | SEJTYCLFUYSFCZ-IZLXSDGUSA-N |
| XLogP | 7.41 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |