C28H37ClN2O3 — CID 101469208
tert-butyl (2R,3S)-7-chloro-2-phenyl-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,3-dihydroindole-1-carboxylate (PubChem CID 101469208) has the molecular formula C28H37ClN2O3 and a molecular weight of 485.07 g/mol. Its IUPAC name is tert-butyl (2R,3S)-7-chloro-2-phenyl-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-7-chloro-2-phenyl-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 101469208 |
| Molecular Formula | C28H37ClN2O3 |
| Molecular Weight | 485.07 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | tert-butyl (2R,3S)-7-chloro-2-phenyl-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,3-dihydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2c(Cl)cccc2[C@H](ON2C(C)(C)CCCC2(C)C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C28H37ClN2O3/c1-26(2,3)33-25(32)30-22(19-13-9-8-10-14-19)24(20-15-11-16-21(29)23(20)30)34-31-27(4,5)17-12-18-28(31,6)7/h8-11,13-16,22,24H,12,17-18H2,1-7H3/t22-,24+/m1/s1 |
| InChIKey | JENQTNVQKZTPBC-VWNXMTODSA-N |
| XLogP | 7.85 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.07 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |