C25H27F3O — CID 101469386
(8S,9S,13S,14S,17S)-13-methyl-17-[4-(trifluoromethyl)phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 101469386) has the molecular formula C25H27F3O and a molecular weight of 400.48 g/mol. Its IUPAC name is (8S,9S,13S,14S,17S)-13-methyl-17-[4-(trifluoromethyl)phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,9S,13S,14S,17S)-13-methyl-17-[4-(trifluoromethyl)phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 101469386 |
| Molecular Formula | C25H27F3O |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (8S,9S,13S,14S,17S)-13-methyl-17-[4-(trifluoromethyl)phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H27F3O/c1-24-13-12-20-19-9-7-18(29)14-16(19)4-8-21(20)23(24)11-10-22(24)15-2-5-17(6-3-15)25(26,27)28/h2-3,5-7,9,14,20-23,29H,4,8,10-13H2,1H3/t20-,21-,22-,23+,24-/m1/s1 |
| InChIKey | UISIIECNKCJANJ-ZSXJVMONSA-N |
| XLogP | 7.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |