C12H12N2O — CID 101470332
(1R,10bS)-2,5,6,10b-tetrahydro-1H-[1,2]oxazolo[3,2-a]isoquinoline-1-carbonitrile (PubChem CID 101470332) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is (1R,10bS)-2,5,6,10b-tetrahydro-1H-[1,2]oxazolo[3,2-a]isoquinoline-1-carbonitrile.
| Compound Name | (1R,10bS)-2,5,6,10b-tetrahydro-1H-[1,2]oxazolo[3,2-a]isoquinoline-1-carbonitrile |
|---|---|
| PubChem CID | 101470332 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | (1R,10bS)-2,5,6,10b-tetrahydro-1H-[1,2]oxazolo[3,2-a]isoquinoline-1-carbonitrile |
| SMILES | N#C[C@@H]1CON2CCc3ccccc3[C@H]12 |
| InChI | InChI=1S/C12H12N2O/c13-7-10-8-15-14-6-5-9-3-1-2-4-11(9)12(10)14/h1-4,10,12H,5-6,8H2/t10-,12+/m1/s1 |
| InChIKey | HPKPMPLZVLEHTM-PWSUYJOCSA-N |
| XLogP | 1.67 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |