About CID 101470724
CID 101470724 (PubChem CID 101470724) has the molecular formula C15H17N2
and a molecular weight of 225.32 g/mol.
Molecular Properties
| Compound Name | CID 101470724 |
| PubChem CID | 101470724 |
| Molecular Formula | C15H17N2 |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | — |
| SMILES | CN1[CH]N(CCC2C=Cc3ccccc32)C=C1 |
| InChI | InChI=1S/C15H17N2/c1-16-10-11-17(12-16)9-8-14-7-6-13-4-2-3-5-15(13)14/h2-7,10-12,14H,8-9H2,1H3 |
| InChIKey | OQGAOGMBSJQIRJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 101470724 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101470724?
The IUPAC name of CID 101470724 (CID 101470724) is not available.
What is the SMILES notation for CID 101470724?
The canonical SMILES for CID 101470724 is CN1[CH]N(CCC2C=Cc3ccccc32)C=C1.
What is the InChIKey of CID 101470724?
The InChIKey is OQGAOGMBSJQIRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N2/c1-16-10-11-17(12-16)9-8-14-7-6-13-4-2-3-5-15(13)14/h2-7,10-12,14H,8-9H2,1H3.
What are the key properties of CID 101470724?
CID 101470724 has a molecular weight of 225.32 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101470724 is sourced from PubChem (CID 101470724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).