C10H18O2 — CID 101471525
cis-ethyl (1R,2R)-2-ethylcyclopentane-1-carboxylate (PubChem CID 101471525) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is cis-ethyl (1R,2R)-2-ethylcyclopentane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2R)-2-ethylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 101471525 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | cis-ethyl (1R,2R)-2-ethylcyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[C@H]1CC |
| InChI | InChI=1S/C10H18O2/c1-3-8-6-5-7-9(8)10(11)12-4-2/h8-9H,3-7H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | WUDQFKYAOWBSAU-RKDXNWHRSA-N |
| XLogP | 2.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |