C13H20N6O3 — CID 101472004
(2S,5R,8R,11S)-2,5,8,11-tetramethyl-1,4,7,10,13,14-hexazabicyclo[10.2.1]pentadeca-12(15),13-diene-3,6,9-trione (PubChem CID 101472004) has the molecular formula C13H20N6O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is (2S,5R,8R,11S)-2,5,8,11-tetramethyl-1,4,7,10,13,14-hexazabicyclo[10.2.1]pentadeca-12(15),13-diene-3,6,9-trione.
| Compound Name | (2S,5R,8R,11S)-2,5,8,11-tetramethyl-1,4,7,10,13,14-hexazabicyclo[10.2.1]pentadeca-12(15),13-diene-3,6,9-trione |
|---|---|
| PubChem CID | 101472004 |
| Molecular Formula | C13H20N6O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (2S,5R,8R,11S)-2,5,8,11-tetramethyl-1,4,7,10,13,14-hexazabicyclo[10.2.1]pentadeca-12(15),13-diene-3,6,9-trione |
| SMILES | C[C@@H]1NC(=O)[C@@H](C)NC(=O)[C@@H](C)NC(=O)[C@H](C)n2cc1nn2 |
| InChI | InChI=1S/C13H20N6O3/c1-6-10-5-19(18-17-10)9(4)13(22)16-8(3)12(21)15-7(2)11(20)14-6/h5-9H,1-4H3,(H,14,20)(H,15,21)(H,16,22)/t6-,7+,8+,9-/m0/s1 |
| InChIKey | QSBGOHRKVIIWRW-KDXUFGMBSA-N |
| XLogP | -0.96 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |