C16H20O4 — CID 101472146
2,2-dimethyl-5-[(2S)-2-phenylbutan-2-yl]-1,3-dioxane-4,6-dione (PubChem CID 101472146) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(2S)-2-phenylbutan-2-yl]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[(2S)-2-phenylbutan-2-yl]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 101472146 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2,2-dimethyl-5-[(2S)-2-phenylbutan-2-yl]-1,3-dioxane-4,6-dione |
| SMILES | CC[C@](C)(c1ccccc1)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C16H20O4/c1-5-16(4,11-9-7-6-8-10-11)12-13(17)19-15(2,3)20-14(12)18/h6-10,12H,5H2,1-4H3/t16-/m1/s1 |
| InChIKey | KXWUGPNVQVMMKY-MRXNPFEDSA-N |
| XLogP | 2.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|