C16H22O6 — CID 101472898
methyl (1R,4aS,7aS)-7-(2,2-dimethylpropanoyloxymethyl)-1-hydroxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 101472898) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is methyl (1R,4aS,7aS)-7-(2,2-dimethylpropanoyloxymethyl)-1-hydroxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (1R,4aS,7aS)-7-(2,2-dimethylpropanoyloxymethyl)-1-hydroxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 101472898 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | methyl (1R,4aS,7aS)-7-(2,2-dimethylpropanoyloxymethyl)-1-hydroxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](O)[C@@H]2C(COC(=O)C(C)(C)C)=CC[C@H]12 |
| InChI | InChI=1S/C16H22O6/c1-16(2,3)15(19)22-7-9-5-6-10-11(13(17)20-4)8-21-14(18)12(9)10/h5,8,10,12,14,18H,6-7H2,1-4H3/t10-,12-,14-/m1/s1 |
| InChIKey | ZBJZGIQJQGJRRV-MPKXVKKWSA-N |
| XLogP | 1.54 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|