About 2-[(1E)-1-ethoxy-3-methylbuta-1,3-dienyl]-1-methylindole
2-[(1E)-1-ethoxy-3-methylbuta-1,3-dienyl]-1-methylindole (PubChem CID 101472976) has the molecular formula C16H19NO
and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-[(1E)-1-ethoxy-3-methylbuta-1,3-dienyl]-1-methylindole.
Molecular Properties
| Compound Name | 2-[(1E)-1-ethoxy-3-methylbuta-1,3-dienyl]-1-methylindole |
| PubChem CID | 101472976 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-[(1E)-1-ethoxy-3-methylbuta-1,3-dienyl]-1-methylindole |
| SMILES | C=C(C)/C=C(/OCC)c1cc2ccccc2n1C |
| InChI | InChI=1S/C16H19NO/c1-5-18-16(10-12(2)3)15-11-13-8-6-7-9-14(13)17(15)4/h6-11H,2,5H2,1,3-4H3/b16-10+ |
| InChIKey | VTKHVVLIHQCRQB-MHWRWJLKSA-N |
| XLogP | 4.13 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E)-1-ethoxy-3-methylbuta-1,3-dienyl]-1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E)-1-ethoxy-3-methylbuta-1,3-dienyl]-1-methylindole?
The IUPAC name of 2-[(1E)-1-ethoxy-3-methylbuta-1,3-dienyl]-1-methylindole (CID 101472976) is 2-[(1E)-1-ethoxy-3-methylbuta-1,3-dienyl]-1-methylindole.
What is the SMILES notation for 2-[(1E)-1-ethoxy-3-methylbuta-1,3-dienyl]-1-methylindole?
The canonical SMILES for 2-[(1E)-1-ethoxy-3-methylbuta-1,3-dienyl]-1-methylindole is C=C(C)/C=C(/OCC)c1cc2ccccc2n1C.
What is the InChIKey of 2-[(1E)-1-ethoxy-3-methylbuta-1,3-dienyl]-1-methylindole?
The InChIKey is VTKHVVLIHQCRQB-MHWRWJLKSA-N. The full InChI is InChI=1S/C16H19NO/c1-5-18-16(10-12(2)3)15-11-13-8-6-7-9-14(13)17(15)4/h6-11H,2,5H2,1,3-4H3/b16-10+.
What are the key properties of 2-[(1E)-1-ethoxy-3-methylbuta-1,3-dienyl]-1-methylindole?
2-[(1E)-1-ethoxy-3-methylbuta-1,3-dienyl]-1-methylindole has a molecular weight of 241.33 g/mol, XLogP of 4.13, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E)-1-ethoxy-3-methylbuta-1,3-dienyl]-1-methylindole is sourced from PubChem (CID 101472976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).