C19H20N2O2-2 — CID 101473488
2-[C-methyl-N-[3-[1-(2-oxidophenyl)ethylideneamino]propyl]carbonimidoyl]phenolate (PubChem CID 101473488) has the molecular formula C19H20N2O2-2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-[C-methyl-N-[3-[1-(2-oxidophenyl)ethylideneamino]propyl]carbonimidoyl]phenolate.
| Compound Name | 2-[C-methyl-N-[3-[1-(2-oxidophenyl)ethylideneamino]propyl]carbonimidoyl]phenolate |
|---|---|
| PubChem CID | 101473488 |
| Molecular Formula | C19H20N2O2-2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-[C-methyl-N-[3-[1-(2-oxidophenyl)ethylideneamino]propyl]carbonimidoyl]phenolate |
| SMILES | C/C(=N\CCC/N=C(\C)c1ccccc1[O-])c1ccccc1[O-] |
| InChI | InChI=1S/C19H22N2O2/c1-14(16-8-3-5-10-18(16)22)20-12-7-13-21-15(2)17-9-4-6-11-19(17)23/h3-6,8-11,22-23H,7,12-13H2,1-2H3/p-2/b20-14+,21-15+ |
| InChIKey | HUUKUBRQVHNIHD-OZNQKUEASA-L |
| XLogP | 2.54 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|