C23H29NO3 — CID 101473708
(2R,3R,6R)-2,3-dimethyl-6-phenyl-N-phenylmethoxy-1,4-dioxaspiro[4.5]decan-6-amine (PubChem CID 101473708) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (2R,3R,6R)-2,3-dimethyl-6-phenyl-N-phenylmethoxy-1,4-dioxaspiro[4.5]decan-6-amine.
| Compound Name | (2R,3R,6R)-2,3-dimethyl-6-phenyl-N-phenylmethoxy-1,4-dioxaspiro[4.5]decan-6-amine |
|---|---|
| PubChem CID | 101473708 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (2R,3R,6R)-2,3-dimethyl-6-phenyl-N-phenylmethoxy-1,4-dioxaspiro[4.5]decan-6-amine |
| SMILES | C[C@H]1OC2(CCCC[C@@]2(NOCc2ccccc2)c2ccccc2)O[C@@H]1C |
| InChI | InChI=1S/C23H29NO3/c1-18-19(2)27-23(26-18)16-10-9-15-22(23,21-13-7-4-8-14-21)24-25-17-20-11-5-3-6-12-20/h3-8,11-14,18-19,24H,9-10,15-17H2,1-2H3/t18-,19-,22-/m1/s1 |
| InChIKey | GSHVYLHFJXFMDY-WOIUINJBSA-N |
| XLogP | 4.70 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|