C28H32O9S2 — CID 101473857
tetramethyl (1R,2R,5S,6R,8R,11R)-6,8-dimethyl-5,11-dithiophen-2-yl-7-oxatricyclo[6.3.0.02,6]undecane-3,3,9,9-tetracarboxylate (PubChem CID 101473857) has the molecular formula C28H32O9S2 and a molecular weight of 576.69 g/mol. Its IUPAC name is tetramethyl (1R,2R,5S,6R,8R,11R)-6,8-dimethyl-5,11-dithiophen-2-yl-7-oxatricyclo[6.3.0.02,6]undecane-3,3,9,9-tetracarboxylate.
| Compound Name | tetramethyl (1R,2R,5S,6R,8R,11R)-6,8-dimethyl-5,11-dithiophen-2-yl-7-oxatricyclo[6.3.0.02,6]undecane-3,3,9,9-tetracarboxylate |
|---|---|
| PubChem CID | 101473857 |
| Molecular Formula | C28H32O9S2 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | tetramethyl (1R,2R,5S,6R,8R,11R)-6,8-dimethyl-5,11-dithiophen-2-yl-7-oxatricyclo[6.3.0.02,6]undecane-3,3,9,9-tetracarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](c2cccs2)[C@]2(C)O[C@]3(C)[C@H]([C@H]12)[C@H](c1cccs1)CC3(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C28H32O9S2/c1-25-16(18-10-8-12-39-18)14-27(21(29)33-3,22(30)34-4)20(25)19-15(17-9-7-11-38-17)13-28(23(31)35-5,24(32)36-6)26(19,2)37-25/h7-12,15-16,19-20H,13-14H2,1-6H3/t15-,16+,19-,20-,25-,26+/m0/s1 |
| InChIKey | QHRWFPYASRQGAT-RKZJEHFFSA-N |
| XLogP | 3.93 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|