C18H32N2+2 — CID 101474040
3,3,10,10-tetramethyl-3,10-diazoniabicyclo[10.2.2]hexadeca-1(14),12,15-triene (PubChem CID 101474040) has the molecular formula C18H32N2+2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 3,3,10,10-tetramethyl-3,10-diazoniabicyclo[10.2.2]hexadeca-1(14),12,15-triene.
| Compound Name | 3,3,10,10-tetramethyl-3,10-diazoniabicyclo[10.2.2]hexadeca-1(14),12,15-triene |
|---|---|
| PubChem CID | 101474040 |
| Molecular Formula | C18H32N2+2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 3,3,10,10-tetramethyl-3,10-diazoniabicyclo[10.2.2]hexadeca-1(14),12,15-triene |
| SMILES | C[N+]1(C)CCCCCC[N+](C)(C)Cc2ccc(cc2)C1 |
| InChI | InChI=1S/C18H32N2/c1-19(2)13-7-5-6-8-14-20(3,4)16-18-11-9-17(15-19)10-12-18/h9-12H,5-8,13-16H2,1-4H3/q+2 |
| InChIKey | BQNHAKYLSLXJRA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|