C19H16F3NO3 — CID 101474520
2,2,2-trifluoro-N-[(E)-3-oxo-1-phenyl-2-phenylmethoxybut-1-enyl]acetamide (PubChem CID 101474520) has the molecular formula C19H16F3NO3 and a molecular weight of 363.34 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(E)-3-oxo-1-phenyl-2-phenylmethoxybut-1-enyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(E)-3-oxo-1-phenyl-2-phenylmethoxybut-1-enyl]acetamide |
|---|---|
| PubChem CID | 101474520 |
| Molecular Formula | C19H16F3NO3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[(E)-3-oxo-1-phenyl-2-phenylmethoxybut-1-enyl]acetamide |
| SMILES | CC(=O)/C(OCc1ccccc1)=C(\NC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H16F3NO3/c1-13(24)17(26-12-14-8-4-2-5-9-14)16(15-10-6-3-7-11-15)23-18(25)19(20,21)22/h2-11H,12H2,1H3,(H,23,25)/b17-16+ |
| InChIKey | FXSBSPMJWGPYMK-WUKNDPDISA-N |
| XLogP | 3.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|