About 5-[tert-butyl(dimethyl)silyl]penta-2,4-diynenitrile
5-[tert-butyl(dimethyl)silyl]penta-2,4-diynenitrile (PubChem CID 101474836) has the molecular formula C11H15NSi
and a molecular weight of 189.33 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]penta-2,4-diynenitrile.
Molecular Properties
| Compound Name | 5-[tert-butyl(dimethyl)silyl]penta-2,4-diynenitrile |
| PubChem CID | 101474836 |
| Molecular Formula | C11H15NSi |
| Molecular Weight | 189.33 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]penta-2,4-diynenitrile |
| SMILES | CC(C)(C)[Si](C)(C)C#CC#CC#N |
| InChI | InChI=1S/C11H15NSi/c1-11(2,3)13(4,5)10-8-6-7-9-12/h1-5H3 |
| InChIKey | IWODQDGZEYKOMV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[tert-butyl(dimethyl)silyl]penta-2,4-diynenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[tert-butyl(dimethyl)silyl]penta-2,4-diynenitrile?
The IUPAC name of 5-[tert-butyl(dimethyl)silyl]penta-2,4-diynenitrile (CID 101474836) is 5-[tert-butyl(dimethyl)silyl]penta-2,4-diynenitrile.
What is the SMILES notation for 5-[tert-butyl(dimethyl)silyl]penta-2,4-diynenitrile?
The canonical SMILES for 5-[tert-butyl(dimethyl)silyl]penta-2,4-diynenitrile is CC(C)(C)[Si](C)(C)C#CC#CC#N.
What is the InChIKey of 5-[tert-butyl(dimethyl)silyl]penta-2,4-diynenitrile?
The InChIKey is IWODQDGZEYKOMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NSi/c1-11(2,3)13(4,5)10-8-6-7-9-12/h1-5H3.
What are the key properties of 5-[tert-butyl(dimethyl)silyl]penta-2,4-diynenitrile?
5-[tert-butyl(dimethyl)silyl]penta-2,4-diynenitrile has a molecular weight of 189.33 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[tert-butyl(dimethyl)silyl]penta-2,4-diynenitrile is sourced from PubChem (CID 101474836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).