C10H17FO2 — CID 101475233
ethyl (Z)-2-fluoro-3,4,4-trimethylpent-2-enoate (PubChem CID 101475233) has the molecular formula C10H17FO2 and a molecular weight of 188.24 g/mol. Its IUPAC name is ethyl (Z)-2-fluoro-3,4,4-trimethylpent-2-enoate.
| Compound Name | ethyl (Z)-2-fluoro-3,4,4-trimethylpent-2-enoate |
|---|---|
| PubChem CID | 101475233 |
| Molecular Formula | C10H17FO2 |
| Molecular Weight | 188.24 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | ethyl (Z)-2-fluoro-3,4,4-trimethylpent-2-enoate |
| SMILES | CCOC(=O)/C(F)=C(\C)C(C)(C)C |
| InChI | InChI=1S/C10H17FO2/c1-6-13-9(12)8(11)7(2)10(3,4)5/h6H2,1-5H3/b8-7- |
| InChIKey | MWIKVPCWCXWXHT-FPLPWBNLSA-N |
| XLogP | 2.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|