C29H28ClNO3 — CID 101476105
ethyl (2S,3R,4S,5R)-5-(4-chlorophenyl)-3-methyl-3-phenyl-4-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carboxylate (PubChem CID 101476105) has the molecular formula C29H28ClNO3 and a molecular weight of 474.00 g/mol. Its IUPAC name is ethyl (2S,3R,4S,5R)-5-(4-chlorophenyl)-3-methyl-3-phenyl-4-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,3R,4S,5R)-5-(4-chlorophenyl)-3-methyl-3-phenyl-4-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 101476105 |
| Molecular Formula | C29H28ClNO3 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | ethyl (2S,3R,4S,5R)-5-(4-chlorophenyl)-3-methyl-3-phenyl-4-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1N[C@@H](c2ccc(Cl)cc2)[C@@H](C(=O)/C=C/c2ccccc2)[C@]1(C)c1ccccc1 |
| InChI | InChI=1S/C29H28ClNO3/c1-3-34-28(33)27-29(2,22-12-8-5-9-13-22)25(24(32)19-14-20-10-6-4-7-11-20)26(31-27)21-15-17-23(30)18-16-21/h4-19,25-27,31H,3H2,1-2H3/b19-14+/t25-,26+,27-,29+/m1/s1 |
| InChIKey | TVBARPSJGTVMQT-JXAUITTGSA-N |
| XLogP | 5.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|